C11H22N4 — CID 81199518
N',1-dimethyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-6-carboximidamide (PubChem CID 81199518) has the molecular formula C11H22N4 and a molecular weight of 210.32 g/mol. Its IUPAC name is N',1-dimethyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-6-carboximidamide.
| Compound Name | N',1-dimethyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-6-carboximidamide |
|---|---|
| PubChem CID | 81199518 |
| Molecular Formula | C11H22N4 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.18 |
| IUPAC Name | N',1-dimethyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-6-carboximidamide |
| SMILES | C/N=C(\N)N1CCC2C(CCCN2C)C1 |
| InChI | InChI=1S/C11H22N4/c1-13-11(12)15-7-5-10-9(8-15)4-3-6-14(10)2/h9-10H,3-8H2,1-2H3,(H2,12,13) |
| InChIKey | ZXAIUSVRVPNJLV-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|