C17H26ClN3 — CID 81199802
6-[3-(chloromethyl)-4,6-dimethyl-2-pyridinyl]-1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine (PubChem CID 81199802) has the molecular formula C17H26ClN3 and a molecular weight of 307.87 g/mol. Its IUPAC name is 6-[3-(chloromethyl)-4,6-dimethyl-2-pyridinyl]-1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine.
| Compound Name | 6-[3-(chloromethyl)-4,6-dimethyl-2-pyridinyl]-1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine |
|---|---|
| PubChem CID | 81199802 |
| Molecular Formula | C17H26ClN3 |
| Molecular Weight | 307.87 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 6-[3-(chloromethyl)-4,6-dimethyl-2-pyridinyl]-1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine |
| SMILES | Cc1cc(C)c(CCl)c(N2CCC3C(CCCN3C)C2)n1 |
| InChI | InChI=1S/C17H26ClN3/c1-12-9-13(2)19-17(15(12)10-18)21-8-6-16-14(11-21)5-4-7-20(16)3/h9,14,16H,4-8,10-11H2,1-3H3 |
| InChIKey | QSCSVEHXMSHGJH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.87 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|