C18H32N2O — CID 81200334
3,5-dimethyl-2-[(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)methyl]cyclohexan-1-one (PubChem CID 81200334) has the molecular formula C18H32N2O and a molecular weight of 292.47 g/mol. Its IUPAC name is 3,5-dimethyl-2-[(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)methyl]cyclohexan-1-one.
| Compound Name | 3,5-dimethyl-2-[(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)methyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 81200334 |
| Molecular Formula | C18H32N2O |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.25 |
| IUPAC Name | 3,5-dimethyl-2-[(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)methyl]cyclohexan-1-one |
| SMILES | CC1CC(=O)C(CN2CCC3C(CCCN3C)C2)C(C)C1 |
| InChI | InChI=1S/C18H32N2O/c1-13-9-14(2)16(18(21)10-13)12-20-8-6-17-15(11-20)5-4-7-19(17)3/h13-17H,4-12H2,1-3H3 |
| InChIKey | PXZXOYZPKPUBBX-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |