C16H28N2O3 — CID 81200459
3-[(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)methyl]oxane-3-carboxylic acid (PubChem CID 81200459) has the molecular formula C16H28N2O3 and a molecular weight of 296.41 g/mol. Its IUPAC name is 3-[(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)methyl]oxane-3-carboxylic acid.
| Compound Name | 3-[(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)methyl]oxane-3-carboxylic acid |
|---|---|
| PubChem CID | 81200459 |
| Molecular Formula | C16H28N2O3 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | 3-[(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)methyl]oxane-3-carboxylic acid |
| SMILES | CN1CCCC2CN(CC3(C(=O)O)CCCOC3)CCC21 |
| InChI | InChI=1S/C16H28N2O3/c1-17-7-2-4-13-10-18(8-5-14(13)17)11-16(15(19)20)6-3-9-21-12-16/h13-14H,2-12H2,1H3,(H,19,20) |
| InChIKey | DBXCTPVTTLXBQB-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |