C14H22N2O4S — CID 81200685
2-(4-amino-2-methoxyphenyl)sulfinyl-N-(3-methoxypropyl)propanamide (PubChem CID 81200685) has the molecular formula C14H22N2O4S and a molecular weight of 314.41 g/mol. Its IUPAC name is 2-(4-amino-2-methoxyphenyl)sulfinyl-N-(3-methoxypropyl)propanamide.
| Compound Name | 2-(4-amino-2-methoxyphenyl)sulfinyl-N-(3-methoxypropyl)propanamide |
|---|---|
| PubChem CID | 81200685 |
| Molecular Formula | C14H22N2O4S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 2-(4-amino-2-methoxyphenyl)sulfinyl-N-(3-methoxypropyl)propanamide |
| SMILES | COCCCNC(=O)C(C)S(=O)c1ccc(N)cc1OC |
| InChI | InChI=1S/C14H22N2O4S/c1-10(14(17)16-7-4-8-19-2)21(18)13-6-5-11(15)9-12(13)20-3/h5-6,9-10H,4,7-8,15H2,1-3H3,(H,16,17) |
| InChIKey | BYRDHVIHAQQNDL-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|