C15H17BrN2O2S — CID 81201331
4-bromo-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfinyl]aniline (PubChem CID 81201331) has the molecular formula C15H17BrN2O2S and a molecular weight of 369.28 g/mol. Its IUPAC name is 4-bromo-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfinyl]aniline.
| Compound Name | 4-bromo-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfinyl]aniline |
|---|---|
| PubChem CID | 81201331 |
| Molecular Formula | C15H17BrN2O2S |
| Molecular Weight | 369.28 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | 4-bromo-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfinyl]aniline |
| SMILES | COc1c(C)cnc(CS(=O)c2cc(Br)ccc2N)c1C |
| InChI | InChI=1S/C15H17BrN2O2S/c1-9-7-18-13(10(2)15(9)20-3)8-21(19)14-6-11(16)4-5-12(14)17/h4-7H,8,17H2,1-3H3 |
| InChIKey | RSMACROURSBAGU-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.28 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|