C10H9ClN2O2S2 — CID 81201759
4-chloro-3-(1,3-thiazol-2-ylmethylsulfonyl)aniline (PubChem CID 81201759) has the molecular formula C10H9ClN2O2S2 and a molecular weight of 288.78 g/mol. Its IUPAC name is 4-chloro-3-(1,3-thiazol-2-ylmethylsulfonyl)aniline.
| Compound Name | 4-chloro-3-(1,3-thiazol-2-ylmethylsulfonyl)aniline |
|---|---|
| PubChem CID | 81201759 |
| Molecular Formula | C10H9ClN2O2S2 |
| Molecular Weight | 288.78 g/mol |
| Exact Mass | 287.98 |
| IUPAC Name | 4-chloro-3-(1,3-thiazol-2-ylmethylsulfonyl)aniline |
| SMILES | Nc1ccc(Cl)c(S(=O)(=O)Cc2nccs2)c1 |
| InChI | InChI=1S/C10H9ClN2O2S2/c11-8-2-1-7(12)5-9(8)17(14,15)6-10-13-3-4-16-10/h1-5H,6,12H2 |
| InChIKey | WEXLZIRWHJAMEX-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.78 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|