C16H18ClNO2S — CID 81202555
2-chloro-4-[(2,4,6-trimethylphenyl)methylsulfonyl]aniline (PubChem CID 81202555) has the molecular formula C16H18ClNO2S and a molecular weight of 323.85 g/mol. Its IUPAC name is 2-chloro-4-[(2,4,6-trimethylphenyl)methylsulfonyl]aniline.
| Compound Name | 2-chloro-4-[(2,4,6-trimethylphenyl)methylsulfonyl]aniline |
|---|---|
| PubChem CID | 81202555 |
| Molecular Formula | C16H18ClNO2S |
| Molecular Weight | 323.85 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 2-chloro-4-[(2,4,6-trimethylphenyl)methylsulfonyl]aniline |
| SMILES | Cc1cc(C)c(CS(=O)(=O)c2ccc(N)c(Cl)c2)c(C)c1 |
| InChI | InChI=1S/C16H18ClNO2S/c1-10-6-11(2)14(12(3)7-10)9-21(19,20)13-4-5-16(18)15(17)8-13/h4-8H,9,18H2,1-3H3 |
| InChIKey | KLBIFOPOTJZXRG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.85 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|