C13H18ClN3O2 — CID 81202711
5-chloro-2-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]benzenecarboximidamide (PubChem CID 81202711) has the molecular formula C13H18ClN3O2 and a molecular weight of 283.76 g/mol. Its IUPAC name is 5-chloro-2-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]benzenecarboximidamide.
| Compound Name | 5-chloro-2-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 81202711 |
| Molecular Formula | C13H18ClN3O2 |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 5-chloro-2-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(Cl)ccc1N1CC(CO)OCC1C |
| InChI | InChI=1S/C13H18ClN3O2/c1-8-7-19-10(6-18)5-17(8)12-3-2-9(14)4-11(12)13(15)16/h2-4,8,10,18H,5-7H2,1H3,(H3,15,16) |
| InChIKey | QQIFHENKCLQUFJ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|