About [4-(5-amino-4,4-dimethylpentyl)-5-methylmorpholin-2-yl]methanol
[4-(5-amino-4,4-dimethylpentyl)-5-methylmorpholin-2-yl]methanol (PubChem CID 81203343) has the molecular formula C13H28N2O2
and a molecular weight of 244.38 g/mol. Its IUPAC name is [4-(5-amino-4,4-dimethylpentyl)-5-methylmorpholin-2-yl]methanol.
Molecular Properties
| Compound Name | [4-(5-amino-4,4-dimethylpentyl)-5-methylmorpholin-2-yl]methanol |
| PubChem CID | 81203343 |
| Molecular Formula | C13H28N2O2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | [4-(5-amino-4,4-dimethylpentyl)-5-methylmorpholin-2-yl]methanol |
| SMILES | CC1COC(CO)CN1CCCC(C)(C)CN |
| InChI | InChI=1S/C13H28N2O2/c1-11-9-17-12(8-16)7-15(11)6-4-5-13(2,3)10-14/h11-12,16H,4-10,14H2,1-3H3 |
| InChIKey | WMNQYKKILWWCNU-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-(5-amino-4,4-dimethylpentyl)-5-methylmorpholin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(5-amino-4,4-dimethylpentyl)-5-methylmorpholin-2-yl]methanol?
The IUPAC name of [4-(5-amino-4,4-dimethylpentyl)-5-methylmorpholin-2-yl]methanol (CID 81203343) is [4-(5-amino-4,4-dimethylpentyl)-5-methylmorpholin-2-yl]methanol.
What is the SMILES notation for [4-(5-amino-4,4-dimethylpentyl)-5-methylmorpholin-2-yl]methanol?
The canonical SMILES for [4-(5-amino-4,4-dimethylpentyl)-5-methylmorpholin-2-yl]methanol is CC1COC(CO)CN1CCCC(C)(C)CN.
What is the InChIKey of [4-(5-amino-4,4-dimethylpentyl)-5-methylmorpholin-2-yl]methanol?
The InChIKey is WMNQYKKILWWCNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28N2O2/c1-11-9-17-12(8-16)7-15(11)6-4-5-13(2,3)10-14/h11-12,16H,4-10,14H2,1-3H3.
What are the key properties of [4-(5-amino-4,4-dimethylpentyl)-5-methylmorpholin-2-yl]methanol?
[4-(5-amino-4,4-dimethylpentyl)-5-methylmorpholin-2-yl]methanol has a molecular weight of 244.38 g/mol, XLogP of 0.83, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(5-amino-4,4-dimethylpentyl)-5-methylmorpholin-2-yl]methanol is sourced from PubChem (CID 81203343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).