About [4-[4-(aminomethyl)-2,6-difluorophenyl]-5-methylmorpholin-2-yl]methanol
[4-[4-(aminomethyl)-2,6-difluorophenyl]-5-methylmorpholin-2-yl]methanol (PubChem CID 81204114) has the molecular formula C13H18F2N2O2
and a molecular weight of 272.30 g/mol. Its IUPAC name is [4-[4-(aminomethyl)-2,6-difluorophenyl]-5-methylmorpholin-2-yl]methanol.
Molecular Properties
| Compound Name | [4-[4-(aminomethyl)-2,6-difluorophenyl]-5-methylmorpholin-2-yl]methanol |
| PubChem CID | 81204114 |
| Molecular Formula | C13H18F2N2O2 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | [4-[4-(aminomethyl)-2,6-difluorophenyl]-5-methylmorpholin-2-yl]methanol |
| SMILES | CC1COC(CO)CN1c1c(F)cc(CN)cc1F |
| InChI | InChI=1S/C13H18F2N2O2/c1-8-7-19-10(6-18)5-17(8)13-11(14)2-9(4-16)3-12(13)15/h2-3,8,10,18H,4-7,16H2,1H3 |
| InChIKey | ARRWJJJIFKUOGO-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-[4-(aminomethyl)-2,6-difluorophenyl]-5-methylmorpholin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[4-(aminomethyl)-2,6-difluorophenyl]-5-methylmorpholin-2-yl]methanol?
The IUPAC name of [4-[4-(aminomethyl)-2,6-difluorophenyl]-5-methylmorpholin-2-yl]methanol (CID 81204114) is [4-[4-(aminomethyl)-2,6-difluorophenyl]-5-methylmorpholin-2-yl]methanol.
What is the SMILES notation for [4-[4-(aminomethyl)-2,6-difluorophenyl]-5-methylmorpholin-2-yl]methanol?
The canonical SMILES for [4-[4-(aminomethyl)-2,6-difluorophenyl]-5-methylmorpholin-2-yl]methanol is CC1COC(CO)CN1c1c(F)cc(CN)cc1F.
What is the InChIKey of [4-[4-(aminomethyl)-2,6-difluorophenyl]-5-methylmorpholin-2-yl]methanol?
The InChIKey is ARRWJJJIFKUOGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18F2N2O2/c1-8-7-19-10(6-18)5-17(8)13-11(14)2-9(4-16)3-12(13)15/h2-3,8,10,18H,4-7,16H2,1H3.
What are the key properties of [4-[4-(aminomethyl)-2,6-difluorophenyl]-5-methylmorpholin-2-yl]methanol?
[4-[4-(aminomethyl)-2,6-difluorophenyl]-5-methylmorpholin-2-yl]methanol has a molecular weight of 272.30 g/mol, XLogP of 1.01, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-(aminomethyl)-2,6-difluorophenyl]-5-methylmorpholin-2-yl]methanol is sourced from PubChem (CID 81204114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).