C9H16N2O5 — CID 81204430
2-[[2-(hydroxymethyl)morpholine-4-carbonyl]-methylamino]acetic acid (PubChem CID 81204430) has the molecular formula C9H16N2O5 and a molecular weight of 232.24 g/mol. Its IUPAC name is 2-[[2-(hydroxymethyl)morpholine-4-carbonyl]-methylamino]acetic acid.
| Compound Name | 2-[[2-(hydroxymethyl)morpholine-4-carbonyl]-methylamino]acetic acid |
|---|---|
| PubChem CID | 81204430 |
| Molecular Formula | C9H16N2O5 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 2-[[2-(hydroxymethyl)morpholine-4-carbonyl]-methylamino]acetic acid |
| SMILES | CN(CC(=O)O)C(=O)N1CCOC(CO)C1 |
| InChI | InChI=1S/C9H16N2O5/c1-10(5-8(13)14)9(15)11-2-3-16-7(4-11)6-12/h7,12H,2-6H2,1H3,(H,13,14) |
| InChIKey | RJXRKDDTJAMEBR-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |