About [4-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-5-methylmorpholin-2-yl]methanol
[4-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-5-methylmorpholin-2-yl]methanol (PubChem CID 81204811) has the molecular formula C11H17ClN2O2S
and a molecular weight of 276.79 g/mol. Its IUPAC name is [4-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-5-methylmorpholin-2-yl]methanol.
Molecular Properties
| Compound Name | [4-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-5-methylmorpholin-2-yl]methanol |
| PubChem CID | 81204811 |
| Molecular Formula | C11H17ClN2O2S |
| Molecular Weight | 276.79 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | [4-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-5-methylmorpholin-2-yl]methanol |
| SMILES | CC1COC(CO)CN1Cc1nc(CCl)cs1 |
| InChI | InChI=1S/C11H17ClN2O2S/c1-8-6-16-10(5-15)3-14(8)4-11-13-9(2-12)7-17-11/h7-8,10,15H,2-6H2,1H3 |
| InChIKey | RFZITWIDPHUWKX-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.79 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [4-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-5-methylmorpholin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-5-methylmorpholin-2-yl]methanol?
The IUPAC name of [4-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-5-methylmorpholin-2-yl]methanol (CID 81204811) is [4-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-5-methylmorpholin-2-yl]methanol.
What is the SMILES notation for [4-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-5-methylmorpholin-2-yl]methanol?
The canonical SMILES for [4-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-5-methylmorpholin-2-yl]methanol is CC1COC(CO)CN1Cc1nc(CCl)cs1.
What is the InChIKey of [4-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-5-methylmorpholin-2-yl]methanol?
The InChIKey is RFZITWIDPHUWKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17ClN2O2S/c1-8-6-16-10(5-15)3-14(8)4-11-13-9(2-12)7-17-11/h7-8,10,15H,2-6H2,1H3.
What are the key properties of [4-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-5-methylmorpholin-2-yl]methanol?
[4-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-5-methylmorpholin-2-yl]methanol has a molecular weight of 276.79 g/mol, XLogP of 1.46, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-5-methylmorpholin-2-yl]methanol is sourced from PubChem (CID 81204811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).