About [4-(3-amino-1,1,1-trifluorobutan-2-yl)morpholin-2-yl]methanol
[4-(3-amino-1,1,1-trifluorobutan-2-yl)morpholin-2-yl]methanol (PubChem CID 81205428) has the molecular formula C9H17F3N2O2
and a molecular weight of 242.24 g/mol. Its IUPAC name is [4-(3-amino-1,1,1-trifluorobutan-2-yl)morpholin-2-yl]methanol.
Molecular Properties
| Compound Name | [4-(3-amino-1,1,1-trifluorobutan-2-yl)morpholin-2-yl]methanol |
| PubChem CID | 81205428 |
| Molecular Formula | C9H17F3N2O2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | [4-(3-amino-1,1,1-trifluorobutan-2-yl)morpholin-2-yl]methanol |
| SMILES | CC(N)C(N1CCOC(CO)C1)C(F)(F)F |
| InChI | InChI=1S/C9H17F3N2O2/c1-6(13)8(9(10,11)12)14-2-3-16-7(4-14)5-15/h6-8,15H,2-5,13H2,1H3 |
| InChIKey | AELGWAVDQOBJLY-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-(3-amino-1,1,1-trifluorobutan-2-yl)morpholin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3-amino-1,1,1-trifluorobutan-2-yl)morpholin-2-yl]methanol?
The IUPAC name of [4-(3-amino-1,1,1-trifluorobutan-2-yl)morpholin-2-yl]methanol (CID 81205428) is [4-(3-amino-1,1,1-trifluorobutan-2-yl)morpholin-2-yl]methanol.
What is the SMILES notation for [4-(3-amino-1,1,1-trifluorobutan-2-yl)morpholin-2-yl]methanol?
The canonical SMILES for [4-(3-amino-1,1,1-trifluorobutan-2-yl)morpholin-2-yl]methanol is CC(N)C(N1CCOC(CO)C1)C(F)(F)F.
What is the InChIKey of [4-(3-amino-1,1,1-trifluorobutan-2-yl)morpholin-2-yl]methanol?
The InChIKey is AELGWAVDQOBJLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F3N2O2/c1-6(13)8(9(10,11)12)14-2-3-16-7(4-14)5-15/h6-8,15H,2-5,13H2,1H3.
What are the key properties of [4-(3-amino-1,1,1-trifluorobutan-2-yl)morpholin-2-yl]methanol?
[4-(3-amino-1,1,1-trifluorobutan-2-yl)morpholin-2-yl]methanol has a molecular weight of 242.24 g/mol, XLogP of -0.04, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3-amino-1,1,1-trifluorobutan-2-yl)morpholin-2-yl]methanol is sourced from PubChem (CID 81205428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).