C13H21F3N2O2 — CID 81205454
4,4,4-trifluoro-3-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)butanoic acid (PubChem CID 81205454) has the molecular formula C13H21F3N2O2 and a molecular weight of 294.32 g/mol. Its IUPAC name is 4,4,4-trifluoro-3-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)butanoic acid.
| Compound Name | 4,4,4-trifluoro-3-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)butanoic acid |
|---|---|
| PubChem CID | 81205454 |
| Molecular Formula | C13H21F3N2O2 |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 4,4,4-trifluoro-3-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)butanoic acid |
| SMILES | CN1CCCC2CN(C(CC(=O)O)C(F)(F)F)CCC21 |
| InChI | InChI=1S/C13H21F3N2O2/c1-17-5-2-3-9-8-18(6-4-10(9)17)11(7-12(19)20)13(14,15)16/h9-11H,2-8H2,1H3,(H,19,20) |
| InChIKey | YQVKHPIPWGJJQB-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |