C12H18N2O2 — CID 81206068
[4-(4-aminophenyl)-5-methylmorpholin-2-yl]methanol (PubChem CID 81206068) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is [4-(4-aminophenyl)-5-methylmorpholin-2-yl]methanol.
| Compound Name | [4-(4-aminophenyl)-5-methylmorpholin-2-yl]methanol |
|---|---|
| PubChem CID | 81206068 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | [4-(4-aminophenyl)-5-methylmorpholin-2-yl]methanol |
| SMILES | CC1COC(CO)CN1c1ccc(N)cc1 |
| InChI | InChI=1S/C12H18N2O2/c1-9-8-16-12(7-15)6-14(9)11-4-2-10(13)3-5-11/h2-5,9,12,15H,6-8,13H2,1H3 |
| InChIKey | UNTXXYXDDAZFNL-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|