C8H8BrF2NO2S — CID 81206533
4-bromo-2-(2,2-difluoroethylsulfonyl)aniline (PubChem CID 81206533) has the molecular formula C8H8BrF2NO2S and a molecular weight of 300.12 g/mol. Its IUPAC name is 4-bromo-2-(2,2-difluoroethylsulfonyl)aniline.
| Compound Name | 4-bromo-2-(2,2-difluoroethylsulfonyl)aniline |
|---|---|
| PubChem CID | 81206533 |
| Molecular Formula | C8H8BrF2NO2S |
| Molecular Weight | 300.12 g/mol |
| Exact Mass | 298.94 |
| IUPAC Name | 4-bromo-2-(2,2-difluoroethylsulfonyl)aniline |
| SMILES | Nc1ccc(Br)cc1S(=O)(=O)CC(F)F |
| InChI | InChI=1S/C8H8BrF2NO2S/c9-5-1-2-6(12)7(3-5)15(13,14)4-8(10)11/h1-3,8H,4,12H2 |
| InChIKey | BBJAQESIDBIPGZ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.12 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|