C14H21BrN2O2S — CID 81207002
2-(2-amino-5-bromophenyl)sulfinyl-N-(3-methylbutyl)propanamide (PubChem CID 81207002) has the molecular formula C14H21BrN2O2S and a molecular weight of 361.31 g/mol. Its IUPAC name is 2-(2-amino-5-bromophenyl)sulfinyl-N-(3-methylbutyl)propanamide.
| Compound Name | 2-(2-amino-5-bromophenyl)sulfinyl-N-(3-methylbutyl)propanamide |
|---|---|
| PubChem CID | 81207002 |
| Molecular Formula | C14H21BrN2O2S |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 2-(2-amino-5-bromophenyl)sulfinyl-N-(3-methylbutyl)propanamide |
| SMILES | CC(C)CCNC(=O)C(C)S(=O)c1cc(Br)ccc1N |
| InChI | InChI=1S/C14H21BrN2O2S/c1-9(2)6-7-17-14(18)10(3)20(19)13-8-11(15)4-5-12(13)16/h4-5,8-10H,6-7,16H2,1-3H3,(H,17,18) |
| InChIKey | CBXFSGWDTZACKD-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|