C13H20ClN3O2 — CID 81210449
[2-(chloromethyl)morpholin-4-yl]-(1,3-diethylpyrazol-5-yl)methanone (PubChem CID 81210449) has the molecular formula C13H20ClN3O2 and a molecular weight of 285.77 g/mol. Its IUPAC name is [2-(chloromethyl)morpholin-4-yl]-(1,3-diethylpyrazol-5-yl)methanone.
| Compound Name | [2-(chloromethyl)morpholin-4-yl]-(1,3-diethylpyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 81210449 |
| Molecular Formula | C13H20ClN3O2 |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | [2-(chloromethyl)morpholin-4-yl]-(1,3-diethylpyrazol-5-yl)methanone |
| SMILES | CCc1cc(C(=O)N2CCOC(CCl)C2)n(CC)n1 |
| InChI | InChI=1S/C13H20ClN3O2/c1-3-10-7-12(17(4-2)15-10)13(18)16-5-6-19-11(8-14)9-16/h7,11H,3-6,8-9H2,1-2H3 |
| InChIKey | VEXDAUJAJXMACH-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|