C10H16BrN3O3S — CID 81211437
2-(bromomethyl)-5-methyl-4-(1-methylpyrazol-4-yl)sulfonylmorpholine (PubChem CID 81211437) has the molecular formula C10H16BrN3O3S and a molecular weight of 338.23 g/mol. Its IUPAC name is 2-(bromomethyl)-5-methyl-4-(1-methylpyrazol-4-yl)sulfonylmorpholine.
| Compound Name | 2-(bromomethyl)-5-methyl-4-(1-methylpyrazol-4-yl)sulfonylmorpholine |
|---|---|
| PubChem CID | 81211437 |
| Molecular Formula | C10H16BrN3O3S |
| Molecular Weight | 338.23 g/mol |
| Exact Mass | 337.01 |
| IUPAC Name | 2-(bromomethyl)-5-methyl-4-(1-methylpyrazol-4-yl)sulfonylmorpholine |
| SMILES | CC1COC(CBr)CN1S(=O)(=O)c1cnn(C)c1 |
| InChI | InChI=1S/C10H16BrN3O3S/c1-8-7-17-9(3-11)5-14(8)18(15,16)10-4-12-13(2)6-10/h4,6,8-9H,3,5,7H2,1-2H3 |
| InChIKey | ADECACXKINIYDQ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.23 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|