C12H15BrClNO3S — CID 81211858
4-(3-bromophenyl)sulfonyl-2-(chloromethyl)-5-methylmorpholine (PubChem CID 81211858) has the molecular formula C12H15BrClNO3S and a molecular weight of 368.68 g/mol. Its IUPAC name is 4-(3-bromophenyl)sulfonyl-2-(chloromethyl)-5-methylmorpholine.
| Compound Name | 4-(3-bromophenyl)sulfonyl-2-(chloromethyl)-5-methylmorpholine |
|---|---|
| PubChem CID | 81211858 |
| Molecular Formula | C12H15BrClNO3S |
| Molecular Weight | 368.68 g/mol |
| Exact Mass | 366.96 |
| IUPAC Name | 4-(3-bromophenyl)sulfonyl-2-(chloromethyl)-5-methylmorpholine |
| SMILES | CC1COC(CCl)CN1S(=O)(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C12H15BrClNO3S/c1-9-8-18-11(6-14)7-15(9)19(16,17)12-4-2-3-10(13)5-12/h2-5,9,11H,6-8H2,1H3 |
| InChIKey | FUSBOFFXWCTDBQ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.68 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|