C9H14ClN3O3S — CID 81212095
2-(chloromethyl)-4-(1-methylpyrazol-4-yl)sulfonylmorpholine (PubChem CID 81212095) has the molecular formula C9H14ClN3O3S and a molecular weight of 279.75 g/mol. Its IUPAC name is 2-(chloromethyl)-4-(1-methylpyrazol-4-yl)sulfonylmorpholine.
| Compound Name | 2-(chloromethyl)-4-(1-methylpyrazol-4-yl)sulfonylmorpholine |
|---|---|
| PubChem CID | 81212095 |
| Molecular Formula | C9H14ClN3O3S |
| Molecular Weight | 279.75 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | 2-(chloromethyl)-4-(1-methylpyrazol-4-yl)sulfonylmorpholine |
| SMILES | Cn1cc(S(=O)(=O)N2CCOC(CCl)C2)cn1 |
| InChI | InChI=1S/C9H14ClN3O3S/c1-12-7-9(5-11-12)17(14,15)13-2-3-16-8(4-10)6-13/h5,7-8H,2-4,6H2,1H3 |
| InChIKey | DYLPDILHQLTPFL-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.75 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|