C16H17BrN2O2 — CID 81214033
[2-(bromomethyl)-5-methylmorpholin-4-yl]-isoquinolin-1-ylmethanone (PubChem CID 81214033) has the molecular formula C16H17BrN2O2 and a molecular weight of 349.23 g/mol. Its IUPAC name is [2-(bromomethyl)-5-methylmorpholin-4-yl]-isoquinolin-1-ylmethanone.
| Compound Name | [2-(bromomethyl)-5-methylmorpholin-4-yl]-isoquinolin-1-ylmethanone |
|---|---|
| PubChem CID | 81214033 |
| Molecular Formula | C16H17BrN2O2 |
| Molecular Weight | 349.23 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | [2-(bromomethyl)-5-methylmorpholin-4-yl]-isoquinolin-1-ylmethanone |
| SMILES | CC1COC(CBr)CN1C(=O)c1nccc2ccccc12 |
| InChI | InChI=1S/C16H17BrN2O2/c1-11-10-21-13(8-17)9-19(11)16(20)15-14-5-3-2-4-12(14)6-7-18-15/h2-7,11,13H,8-10H2,1H3 |
| InChIKey | NSQHMSXMFWOFGJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.23 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|