C12H14Cl2FNO — CID 81214267
4-[(2-chloro-4-fluorophenyl)methyl]-2-(chloromethyl)morpholine (PubChem CID 81214267) has the molecular formula C12H14Cl2FNO and a molecular weight of 278.15 g/mol. Its IUPAC name is 4-[(2-chloro-4-fluorophenyl)methyl]-2-(chloromethyl)morpholine.
| Compound Name | 4-[(2-chloro-4-fluorophenyl)methyl]-2-(chloromethyl)morpholine |
|---|---|
| PubChem CID | 81214267 |
| Molecular Formula | C12H14Cl2FNO |
| Molecular Weight | 278.15 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 4-[(2-chloro-4-fluorophenyl)methyl]-2-(chloromethyl)morpholine |
| SMILES | Fc1ccc(CN2CCOC(CCl)C2)c(Cl)c1 |
| InChI | InChI=1S/C12H14Cl2FNO/c13-6-11-8-16(3-4-17-11)7-9-1-2-10(15)5-12(9)14/h1-2,5,11H,3-4,6-8H2 |
| InChIKey | YNRKSDUHOZMLOY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.15 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|