C16H25N3 — CID 81215343
2-methyl-6-(4-methyl-1,4-diazepan-1-yl)-1,2,3,4-tetrahydroquinoline (PubChem CID 81215343) has the molecular formula C16H25N3 and a molecular weight of 259.40 g/mol. Its IUPAC name is 2-methyl-6-(4-methyl-1,4-diazepan-1-yl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 2-methyl-6-(4-methyl-1,4-diazepan-1-yl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 81215343 |
| Molecular Formula | C16H25N3 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | 2-methyl-6-(4-methyl-1,4-diazepan-1-yl)-1,2,3,4-tetrahydroquinoline |
| SMILES | CC1CCc2cc(N3CCCN(C)CC3)ccc2N1 |
| InChI | InChI=1S/C16H25N3/c1-13-4-5-14-12-15(6-7-16(14)17-13)19-9-3-8-18(2)10-11-19/h6-7,12-13,17H,3-5,8-11H2,1-2H3 |
| InChIKey | DSRZJTBHSPSYSR-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|