C17H19FN2 — CID 81215536
N-ethyl-N-(2-fluorophenyl)-1,2,3,4-tetrahydroquinolin-8-amine (PubChem CID 81215536) has the molecular formula C17H19FN2 and a molecular weight of 270.35 g/mol. Its IUPAC name is N-ethyl-N-(2-fluorophenyl)-1,2,3,4-tetrahydroquinolin-8-amine.
| Compound Name | N-ethyl-N-(2-fluorophenyl)-1,2,3,4-tetrahydroquinolin-8-amine |
|---|---|
| PubChem CID | 81215536 |
| Molecular Formula | C17H19FN2 |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | N-ethyl-N-(2-fluorophenyl)-1,2,3,4-tetrahydroquinolin-8-amine |
| SMILES | CCN(c1ccccc1F)c1cccc2c1NCCC2 |
| InChI | InChI=1S/C17H19FN2/c1-2-20(15-10-4-3-9-14(15)18)16-11-5-7-13-8-6-12-19-17(13)16/h3-5,7,9-11,19H,2,6,8,12H2,1H3 |
| InChIKey | YXCCIOGYLSADMX-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |