C15H20N4 — CID 81215543
N-methyl-N-[(1-methylimidazol-2-yl)methyl]-1,2,3,4-tetrahydroquinolin-6-amine (PubChem CID 81215543) has the molecular formula C15H20N4 and a molecular weight of 256.35 g/mol. Its IUPAC name is N-methyl-N-[(1-methylimidazol-2-yl)methyl]-1,2,3,4-tetrahydroquinolin-6-amine.
| Compound Name | N-methyl-N-[(1-methylimidazol-2-yl)methyl]-1,2,3,4-tetrahydroquinolin-6-amine |
|---|---|
| PubChem CID | 81215543 |
| Molecular Formula | C15H20N4 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | N-methyl-N-[(1-methylimidazol-2-yl)methyl]-1,2,3,4-tetrahydroquinolin-6-amine |
| SMILES | CN(Cc1nccn1C)c1ccc2c(c1)CCCN2 |
| InChI | InChI=1S/C15H20N4/c1-18-9-8-17-15(18)11-19(2)13-5-6-14-12(10-13)4-3-7-16-14/h5-6,8-10,16H,3-4,7,11H2,1-2H3 |
| InChIKey | KEGNORYBRWDTGX-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|