C11H21N7O2 — CID 81217356
[4-[4-(dimethylamino)-6-hydrazinyl-1,3,5-triazin-2-yl]-5-methylmorpholin-2-yl]methanol (PubChem CID 81217356) has the molecular formula C11H21N7O2 and a molecular weight of 283.34 g/mol. Its IUPAC name is [4-[4-(dimethylamino)-6-hydrazinyl-1,3,5-triazin-2-yl]-5-methylmorpholin-2-yl]methanol.
| Compound Name | [4-[4-(dimethylamino)-6-hydrazinyl-1,3,5-triazin-2-yl]-5-methylmorpholin-2-yl]methanol |
|---|---|
| PubChem CID | 81217356 |
| Molecular Formula | C11H21N7O2 |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | [4-[4-(dimethylamino)-6-hydrazinyl-1,3,5-triazin-2-yl]-5-methylmorpholin-2-yl]methanol |
| SMILES | CC1COC(CO)CN1c1nc(NN)nc(N(C)C)n1 |
| InChI | InChI=1S/C11H21N7O2/c1-7-6-20-8(5-19)4-18(7)11-14-9(16-12)13-10(15-11)17(2)3/h7-8,19H,4-6,12H2,1-3H3,(H,13,14,15,16) |
| InChIKey | JHRRBIQHZJNELH-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|