C11H18N4O2 — CID 81218201
[5-methyl-4-[2-(methylamino)pyrimidin-4-yl]morpholin-2-yl]methanol (PubChem CID 81218201) has the molecular formula C11H18N4O2 and a molecular weight of 238.29 g/mol. Its IUPAC name is [5-methyl-4-[2-(methylamino)pyrimidin-4-yl]morpholin-2-yl]methanol.
| Compound Name | [5-methyl-4-[2-(methylamino)pyrimidin-4-yl]morpholin-2-yl]methanol |
|---|---|
| PubChem CID | 81218201 |
| Molecular Formula | C11H18N4O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | [5-methyl-4-[2-(methylamino)pyrimidin-4-yl]morpholin-2-yl]methanol |
| SMILES | CNc1nccc(N2CC(CO)OCC2C)n1 |
| InChI | InChI=1S/C11H18N4O2/c1-8-7-17-9(6-16)5-15(8)10-3-4-13-11(12-2)14-10/h3-4,8-9,16H,5-7H2,1-2H3,(H,12,13,14) |
| InChIKey | HPQFFMODXQCZAA-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |