About [5-methyl-4-(1,3,5-trimethylpyrazol-4-yl)sulfonylmorpholin-2-yl]methanol
[5-methyl-4-(1,3,5-trimethylpyrazol-4-yl)sulfonylmorpholin-2-yl]methanol (PubChem CID 81219818) has the molecular formula C12H21N3O4S
and a molecular weight of 303.38 g/mol. Its IUPAC name is [5-methyl-4-(1,3,5-trimethylpyrazol-4-yl)sulfonylmorpholin-2-yl]methanol.
Molecular Properties
| Compound Name | [5-methyl-4-(1,3,5-trimethylpyrazol-4-yl)sulfonylmorpholin-2-yl]methanol |
| PubChem CID | 81219818 |
| Molecular Formula | C12H21N3O4S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | [5-methyl-4-(1,3,5-trimethylpyrazol-4-yl)sulfonylmorpholin-2-yl]methanol |
| SMILES | Cc1nn(C)c(C)c1S(=O)(=O)N1CC(CO)OCC1C |
| InChI | InChI=1S/C12H21N3O4S/c1-8-7-19-11(6-16)5-15(8)20(17,18)12-9(2)13-14(4)10(12)3/h8,11,16H,5-7H2,1-4H3 |
| InChIKey | DKFQRBHNGNIZKH-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [5-methyl-4-(1,3,5-trimethylpyrazol-4-yl)sulfonylmorpholin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-methyl-4-(1,3,5-trimethylpyrazol-4-yl)sulfonylmorpholin-2-yl]methanol?
The IUPAC name of [5-methyl-4-(1,3,5-trimethylpyrazol-4-yl)sulfonylmorpholin-2-yl]methanol (CID 81219818) is [5-methyl-4-(1,3,5-trimethylpyrazol-4-yl)sulfonylmorpholin-2-yl]methanol.
What is the SMILES notation for [5-methyl-4-(1,3,5-trimethylpyrazol-4-yl)sulfonylmorpholin-2-yl]methanol?
The canonical SMILES for [5-methyl-4-(1,3,5-trimethylpyrazol-4-yl)sulfonylmorpholin-2-yl]methanol is Cc1nn(C)c(C)c1S(=O)(=O)N1CC(CO)OCC1C.
What is the InChIKey of [5-methyl-4-(1,3,5-trimethylpyrazol-4-yl)sulfonylmorpholin-2-yl]methanol?
The InChIKey is DKFQRBHNGNIZKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3O4S/c1-8-7-19-11(6-16)5-15(8)20(17,18)12-9(2)13-14(4)10(12)3/h8,11,16H,5-7H2,1-4H3.
What are the key properties of [5-methyl-4-(1,3,5-trimethylpyrazol-4-yl)sulfonylmorpholin-2-yl]methanol?
[5-methyl-4-(1,3,5-trimethylpyrazol-4-yl)sulfonylmorpholin-2-yl]methanol has a molecular weight of 303.38 g/mol, XLogP of -0.19, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-methyl-4-(1,3,5-trimethylpyrazol-4-yl)sulfonylmorpholin-2-yl]methanol is sourced from PubChem (CID 81219818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).