C15H17N3O2 — CID 81222427
4-(2-ethoxyphenoxy)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine (PubChem CID 81222427) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is 4-(2-ethoxyphenoxy)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine.
| Compound Name | 4-(2-ethoxyphenoxy)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 81222427 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 4-(2-ethoxyphenoxy)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine |
| SMILES | CCOc1ccccc1Oc1ncnc2c1CNCC2 |
| InChI | InChI=1S/C15H17N3O2/c1-2-19-13-5-3-4-6-14(13)20-15-11-9-16-8-7-12(11)17-10-18-15/h3-6,10,16H,2,7-9H2,1H3 |
| InChIKey | CLVSCAVVBUJYGB-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |