About 7-fluoro-4-methoxy-3,3-dimethyl-1,2-dihydroindole
7-fluoro-4-methoxy-3,3-dimethyl-1,2-dihydroindole (PubChem CID 81222524) has the molecular formula C11H14FNO
and a molecular weight of 195.24 g/mol. Its IUPAC name is 7-fluoro-4-methoxy-3,3-dimethyl-1,2-dihydroindole.
Molecular Properties
| Compound Name | 7-fluoro-4-methoxy-3,3-dimethyl-1,2-dihydroindole |
| PubChem CID | 81222524 |
| Molecular Formula | C11H14FNO |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | 7-fluoro-4-methoxy-3,3-dimethyl-1,2-dihydroindole |
| SMILES | COc1ccc(F)c2c1C(C)(C)CN2 |
| InChI | InChI=1S/C11H14FNO/c1-11(2)6-13-10-7(12)4-5-8(14-3)9(10)11/h4-5,13H,6H2,1-3H3 |
| InChIKey | SIPYUPCVJPNJSQ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-fluoro-4-methoxy-3,3-dimethyl-1,2-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-4-methoxy-3,3-dimethyl-1,2-dihydroindole?
The IUPAC name of 7-fluoro-4-methoxy-3,3-dimethyl-1,2-dihydroindole (CID 81222524) is 7-fluoro-4-methoxy-3,3-dimethyl-1,2-dihydroindole.
What is the SMILES notation for 7-fluoro-4-methoxy-3,3-dimethyl-1,2-dihydroindole?
The canonical SMILES for 7-fluoro-4-methoxy-3,3-dimethyl-1,2-dihydroindole is COc1ccc(F)c2c1C(C)(C)CN2.
What is the InChIKey of 7-fluoro-4-methoxy-3,3-dimethyl-1,2-dihydroindole?
The InChIKey is SIPYUPCVJPNJSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14FNO/c1-11(2)6-13-10-7(12)4-5-8(14-3)9(10)11/h4-5,13H,6H2,1-3H3.
What are the key properties of 7-fluoro-4-methoxy-3,3-dimethyl-1,2-dihydroindole?
7-fluoro-4-methoxy-3,3-dimethyl-1,2-dihydroindole has a molecular weight of 195.24 g/mol, XLogP of 2.54, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-4-methoxy-3,3-dimethyl-1,2-dihydroindole is sourced from PubChem (CID 81222524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).