C9H9BrN2O2 — CID 81222711
2-(bromomethyl)-5-(2,5-dimethylfuran-3-yl)-1,3,4-oxadiazole (PubChem CID 81222711) has the molecular formula C9H9BrN2O2 and a molecular weight of 257.09 g/mol. Its IUPAC name is 2-(bromomethyl)-5-(2,5-dimethylfuran-3-yl)-1,3,4-oxadiazole.
| Compound Name | 2-(bromomethyl)-5-(2,5-dimethylfuran-3-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 81222711 |
| Molecular Formula | C9H9BrN2O2 |
| Molecular Weight | 257.09 g/mol |
| Exact Mass | 255.98 |
| IUPAC Name | 2-(bromomethyl)-5-(2,5-dimethylfuran-3-yl)-1,3,4-oxadiazole |
| SMILES | Cc1cc(-c2nnc(CBr)o2)c(C)o1 |
| InChI | InChI=1S/C9H9BrN2O2/c1-5-3-7(6(2)13-5)9-12-11-8(4-10)14-9/h3H,4H2,1-2H3 |
| InChIKey | BGTZSCRJGRJBMP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.09 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|