C15H18N4 — CID 81223209
N-methyl-N-(3-methylphenyl)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-amine (PubChem CID 81223209) has the molecular formula C15H18N4 and a molecular weight of 254.34 g/mol. Its IUPAC name is N-methyl-N-(3-methylphenyl)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-amine.
| Compound Name | N-methyl-N-(3-methylphenyl)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 81223209 |
| Molecular Formula | C15H18N4 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | N-methyl-N-(3-methylphenyl)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-amine |
| SMILES | Cc1cccc(N(C)c2ncnc3c2CNCC3)c1 |
| InChI | InChI=1S/C15H18N4/c1-11-4-3-5-12(8-11)19(2)15-13-9-16-7-6-14(13)17-10-18-15/h3-5,8,10,16H,6-7,9H2,1-2H3 |
| InChIKey | FZTJSXHUMUZAFV-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|