C12H17F3N4 — CID 81223294
N-propan-2-yl-N-(2,2,2-trifluoroethyl)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-amine (PubChem CID 81223294) has the molecular formula C12H17F3N4 and a molecular weight of 274.29 g/mol. Its IUPAC name is N-propan-2-yl-N-(2,2,2-trifluoroethyl)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-amine.
| Compound Name | N-propan-2-yl-N-(2,2,2-trifluoroethyl)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 81223294 |
| Molecular Formula | C12H17F3N4 |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | N-propan-2-yl-N-(2,2,2-trifluoroethyl)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-amine |
| SMILES | CC(C)N(CC(F)(F)F)c1ncnc2c1CNCC2 |
| InChI | InChI=1S/C12H17F3N4/c1-8(2)19(6-12(13,14)15)11-9-5-16-4-3-10(9)17-7-18-11/h7-8,16H,3-6H2,1-2H3 |
| InChIKey | SAWALBIKJUSRLU-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |