C15H17FN4 — CID 81223554
N-ethyl-N-(2-fluorophenyl)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-amine (PubChem CID 81223554) has the molecular formula C15H17FN4 and a molecular weight of 272.33 g/mol. Its IUPAC name is N-ethyl-N-(2-fluorophenyl)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-amine.
| Compound Name | N-ethyl-N-(2-fluorophenyl)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 81223554 |
| Molecular Formula | C15H17FN4 |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | N-ethyl-N-(2-fluorophenyl)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-amine |
| SMILES | CCN(c1ccccc1F)c1ncnc2c1CNCC2 |
| InChI | InChI=1S/C15H17FN4/c1-2-20(14-6-4-3-5-12(14)16)15-11-9-17-8-7-13(11)18-10-19-15/h3-6,10,17H,2,7-9H2,1H3 |
| InChIKey | RSOZLPJJOUCCHN-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|