C10H10F5N3O — CID 81223652
4-(2,2,3,3,3-pentafluoropropoxy)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine (PubChem CID 81223652) has the molecular formula C10H10F5N3O and a molecular weight of 283.20 g/mol. Its IUPAC name is 4-(2,2,3,3,3-pentafluoropropoxy)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine.
| Compound Name | 4-(2,2,3,3,3-pentafluoropropoxy)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 81223652 |
| Molecular Formula | C10H10F5N3O |
| Molecular Weight | 283.20 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 4-(2,2,3,3,3-pentafluoropropoxy)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine |
| SMILES | FC(F)(F)C(F)(F)COc1ncnc2c1CNCC2 |
| InChI | InChI=1S/C10H10F5N3O/c11-9(12,10(13,14)15)4-19-8-6-3-16-2-1-7(6)17-5-18-8/h5,16H,1-4H2 |
| InChIKey | ROOIKJKBWXIIJO-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.20 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|