C14H17N3 — CID 81224686
7-(2-ethylimidazol-1-yl)-1,2,3,4-tetrahydroquinoline (PubChem CID 81224686) has the molecular formula C14H17N3 and a molecular weight of 227.31 g/mol. Its IUPAC name is 7-(2-ethylimidazol-1-yl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 7-(2-ethylimidazol-1-yl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 81224686 |
| Molecular Formula | C14H17N3 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 7-(2-ethylimidazol-1-yl)-1,2,3,4-tetrahydroquinoline |
| SMILES | CCc1nccn1-c1ccc2c(c1)NCCC2 |
| InChI | InChI=1S/C14H17N3/c1-2-14-16-8-9-17(14)12-6-5-11-4-3-7-15-13(11)10-12/h5-6,8-10,15H,2-4,7H2,1H3 |
| InChIKey | BCKYPBXFJZEPBC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |