C10H13ClN2O — CID 81225000
4-chloro-N-ethyl-N,6-dimethylpyridine-3-carboxamide (PubChem CID 81225000) has the molecular formula C10H13ClN2O and a molecular weight of 212.68 g/mol. Its IUPAC name is 4-chloro-N-ethyl-N,6-dimethylpyridine-3-carboxamide.
| Compound Name | 4-chloro-N-ethyl-N,6-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 81225000 |
| Molecular Formula | C10H13ClN2O |
| Molecular Weight | 212.68 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 4-chloro-N-ethyl-N,6-dimethylpyridine-3-carboxamide |
| SMILES | CCN(C)C(=O)c1cnc(C)cc1Cl |
| InChI | InChI=1S/C10H13ClN2O/c1-4-13(3)10(14)8-6-12-7(2)5-9(8)11/h5-6H,4H2,1-3H3 |
| InChIKey | PICVPMRQTYAASA-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.68 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |