About 4-chloro-6-methyl-N-(2,4,6-triiodophenyl)pyridine-3-carboxamide
4-chloro-6-methyl-N-(2,4,6-triiodophenyl)pyridine-3-carboxamide (PubChem CID 81226665) has the molecular formula C13H8ClI3N2O
and a molecular weight of 624.38 g/mol. Its IUPAC name is 4-chloro-6-methyl-N-(2,4,6-triiodophenyl)pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 4-chloro-6-methyl-N-(2,4,6-triiodophenyl)pyridine-3-carboxamide |
| PubChem CID | 81226665 |
| Molecular Formula | C13H8ClI3N2O |
| Molecular Weight | 624.38 g/mol |
| Exact Mass | 623.75 |
| IUPAC Name | 4-chloro-6-methyl-N-(2,4,6-triiodophenyl)pyridine-3-carboxamide |
| SMILES | Cc1cc(Cl)c(C(=O)Nc2c(I)cc(I)cc2I)cn1 |
| InChI | InChI=1S/C13H8ClI3N2O/c1-6-2-9(14)8(5-18-6)13(20)19-12-10(16)3-7(15)4-11(12)17/h2-5H,1H3,(H,19,20) |
| InChIKey | WZVWNHOXCRQQFA-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 624.38 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-6-methyl-N-(2,4,6-triiodophenyl)pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6-methyl-N-(2,4,6-triiodophenyl)pyridine-3-carboxamide?
The IUPAC name of 4-chloro-6-methyl-N-(2,4,6-triiodophenyl)pyridine-3-carboxamide (CID 81226665) is 4-chloro-6-methyl-N-(2,4,6-triiodophenyl)pyridine-3-carboxamide.
What is the SMILES notation for 4-chloro-6-methyl-N-(2,4,6-triiodophenyl)pyridine-3-carboxamide?
The canonical SMILES for 4-chloro-6-methyl-N-(2,4,6-triiodophenyl)pyridine-3-carboxamide is Cc1cc(Cl)c(C(=O)Nc2c(I)cc(I)cc2I)cn1.
What is the InChIKey of 4-chloro-6-methyl-N-(2,4,6-triiodophenyl)pyridine-3-carboxamide?
The InChIKey is WZVWNHOXCRQQFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8ClI3N2O/c1-6-2-9(14)8(5-18-6)13(20)19-12-10(16)3-7(15)4-11(12)17/h2-5H,1H3,(H,19,20).
What are the key properties of 4-chloro-6-methyl-N-(2,4,6-triiodophenyl)pyridine-3-carboxamide?
4-chloro-6-methyl-N-(2,4,6-triiodophenyl)pyridine-3-carboxamide has a molecular weight of 624.38 g/mol, XLogP of 5.11, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6-methyl-N-(2,4,6-triiodophenyl)pyridine-3-carboxamide is sourced from PubChem (CID 81226665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).