C14H12BrClN2O — CID 81226921
N-(3-bromo-4-methylphenyl)-4-chloro-6-methylpyridine-3-carboxamide (PubChem CID 81226921) has the molecular formula C14H12BrClN2O and a molecular weight of 339.62 g/mol. Its IUPAC name is N-(3-bromo-4-methylphenyl)-4-chloro-6-methylpyridine-3-carboxamide.
| Compound Name | N-(3-bromo-4-methylphenyl)-4-chloro-6-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 81226921 |
| Molecular Formula | C14H12BrClN2O |
| Molecular Weight | 339.62 g/mol |
| Exact Mass | 337.98 |
| IUPAC Name | N-(3-bromo-4-methylphenyl)-4-chloro-6-methylpyridine-3-carboxamide |
| SMILES | Cc1cc(Cl)c(C(=O)Nc2ccc(C)c(Br)c2)cn1 |
| InChI | InChI=1S/C14H12BrClN2O/c1-8-3-4-10(6-12(8)15)18-14(19)11-7-17-9(2)5-13(11)16/h3-7H,1-2H3,(H,18,19) |
| InChIKey | JXFGRKVTQFDLFU-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.62 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |