C10H13ClN2O3 — CID 81227403
4-chloro-N,N-bis(2-hydroxyethyl)pyridine-3-carboxamide (PubChem CID 81227403) has the molecular formula C10H13ClN2O3 and a molecular weight of 244.68 g/mol. Its IUPAC name is 4-chloro-N,N-bis(2-hydroxyethyl)pyridine-3-carboxamide.
| Compound Name | 4-chloro-N,N-bis(2-hydroxyethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 81227403 |
| Molecular Formula | C10H13ClN2O3 |
| Molecular Weight | 244.68 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 4-chloro-N,N-bis(2-hydroxyethyl)pyridine-3-carboxamide |
| SMILES | O=C(c1cnccc1Cl)N(CCO)CCO |
| InChI | InChI=1S/C10H13ClN2O3/c11-9-1-2-12-7-8(9)10(16)13(3-5-14)4-6-15/h1-2,7,14-15H,3-6H2 |
| InChIKey | JOQYNMBUTATUQS-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.68 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |