C17H14F2N2 — CID 81227602
2-(3,5-difluorophenyl)-1-quinolin-8-ylethanamine (PubChem CID 81227602) has the molecular formula C17H14F2N2 and a molecular weight of 284.31 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)-1-quinolin-8-ylethanamine.
| Compound Name | 2-(3,5-difluorophenyl)-1-quinolin-8-ylethanamine |
|---|---|
| PubChem CID | 81227602 |
| Molecular Formula | C17H14F2N2 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 2-(3,5-difluorophenyl)-1-quinolin-8-ylethanamine |
| SMILES | NC(Cc1cc(F)cc(F)c1)c1cccc2cccnc12 |
| InChI | InChI=1S/C17H14F2N2/c18-13-7-11(8-14(19)10-13)9-16(20)15-5-1-3-12-4-2-6-21-17(12)15/h1-8,10,16H,9,20H2 |
| InChIKey | RMJHFOYLABCDHM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |