About 2-(1,1-dioxothiolan-3-yl)sulfonyl-2-methylpropanoic acid
2-(1,1-dioxothiolan-3-yl)sulfonyl-2-methylpropanoic acid (PubChem CID 81227757) has the molecular formula C8H14O6S2
and a molecular weight of 270.33 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)sulfonyl-2-methylpropanoic acid.
Molecular Properties
| Compound Name | 2-(1,1-dioxothiolan-3-yl)sulfonyl-2-methylpropanoic acid |
| PubChem CID | 81227757 |
| Molecular Formula | C8H14O6S2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.02 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)sulfonyl-2-methylpropanoic acid |
| SMILES | CC(C)(C(=O)O)S(=O)(=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H14O6S2/c1-8(2,7(9)10)16(13,14)6-3-4-15(11,12)5-6/h6H,3-5H2,1-2H3,(H,9,10) |
| InChIKey | DEKKFCZOVCUYFZ-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 105.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1,1-dioxothiolan-3-yl)sulfonyl-2-methylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,1-dioxothiolan-3-yl)sulfonyl-2-methylpropanoic acid?
The IUPAC name of 2-(1,1-dioxothiolan-3-yl)sulfonyl-2-methylpropanoic acid (CID 81227757) is 2-(1,1-dioxothiolan-3-yl)sulfonyl-2-methylpropanoic acid.
What is the SMILES notation for 2-(1,1-dioxothiolan-3-yl)sulfonyl-2-methylpropanoic acid?
The canonical SMILES for 2-(1,1-dioxothiolan-3-yl)sulfonyl-2-methylpropanoic acid is CC(C)(C(=O)O)S(=O)(=O)C1CCS(=O)(=O)C1.
What is the InChIKey of 2-(1,1-dioxothiolan-3-yl)sulfonyl-2-methylpropanoic acid?
The InChIKey is DEKKFCZOVCUYFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O6S2/c1-8(2,7(9)10)16(13,14)6-3-4-15(11,12)5-6/h6H,3-5H2,1-2H3,(H,9,10).
What are the key properties of 2-(1,1-dioxothiolan-3-yl)sulfonyl-2-methylpropanoic acid?
2-(1,1-dioxothiolan-3-yl)sulfonyl-2-methylpropanoic acid has a molecular weight of 270.33 g/mol, XLogP of -0.55, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-dioxothiolan-3-yl)sulfonyl-2-methylpropanoic acid is sourced from PubChem (CID 81227757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).