C11H12FNO5S — CID 81227808
2-[(3-fluoro-4-nitrophenyl)methylsulfinyl]-2-methylpropanoic acid (PubChem CID 81227808) has the molecular formula C11H12FNO5S and a molecular weight of 289.28 g/mol. Its IUPAC name is 2-[(3-fluoro-4-nitrophenyl)methylsulfinyl]-2-methylpropanoic acid.
| Compound Name | 2-[(3-fluoro-4-nitrophenyl)methylsulfinyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 81227808 |
| Molecular Formula | C11H12FNO5S |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | 2-[(3-fluoro-4-nitrophenyl)methylsulfinyl]-2-methylpropanoic acid |
| SMILES | CC(C)(C(=O)O)S(=O)Cc1ccc([N+](=O)[O-])c(F)c1 |
| InChI | InChI=1S/C11H12FNO5S/c1-11(2,10(14)15)19(18)6-7-3-4-9(13(16)17)8(12)5-7/h3-5H,6H2,1-2H3,(H,14,15) |
| InChIKey | VVYXUFZSQPTBQS-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 97.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|