C7H11F3O5S — CID 81229414
2-methyl-2-[2-(trifluoromethoxy)ethylsulfonyl]propanoic acid (PubChem CID 81229414) has the molecular formula C7H11F3O5S and a molecular weight of 264.22 g/mol. Its IUPAC name is 2-methyl-2-[2-(trifluoromethoxy)ethylsulfonyl]propanoic acid.
| Compound Name | 2-methyl-2-[2-(trifluoromethoxy)ethylsulfonyl]propanoic acid |
|---|---|
| PubChem CID | 81229414 |
| Molecular Formula | C7H11F3O5S |
| Molecular Weight | 264.22 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | 2-methyl-2-[2-(trifluoromethoxy)ethylsulfonyl]propanoic acid |
| SMILES | CC(C)(C(=O)O)S(=O)(=O)CCOC(F)(F)F |
| InChI | InChI=1S/C7H11F3O5S/c1-6(2,5(11)12)16(13,14)4-3-15-7(8,9)10/h3-4H2,1-2H3,(H,11,12) |
| InChIKey | PJQYNYWVTPELCL-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.22 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |