C7H13NO4S — CID 81230491
2-(1-amino-1-oxopropan-2-yl)sulfinyl-2-methylpropanoic acid (PubChem CID 81230491) has the molecular formula C7H13NO4S and a molecular weight of 207.25 g/mol. Its IUPAC name is 2-(1-amino-1-oxopropan-2-yl)sulfinyl-2-methylpropanoic acid.
| Compound Name | 2-(1-amino-1-oxopropan-2-yl)sulfinyl-2-methylpropanoic acid |
|---|---|
| PubChem CID | 81230491 |
| Molecular Formula | C7H13NO4S |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 2-(1-amino-1-oxopropan-2-yl)sulfinyl-2-methylpropanoic acid |
| SMILES | CC(C(N)=O)S(=O)C(C)(C)C(=O)O |
| InChI | InChI=1S/C7H13NO4S/c1-4(5(8)9)13(12)7(2,3)6(10)11/h4H,1-3H3,(H2,8,9)(H,10,11) |
| InChIKey | YGJLFYMJRXYFBE-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |