About 7-(4-chloro-6-propoxy-1,3,5-triazin-2-yl)quinoline
7-(4-chloro-6-propoxy-1,3,5-triazin-2-yl)quinoline (PubChem CID 81230886) has the molecular formula C15H13ClN4O
and a molecular weight of 300.75 g/mol. Its IUPAC name is 7-(4-chloro-6-propoxy-1,3,5-triazin-2-yl)quinoline.
Molecular Properties
| Compound Name | 7-(4-chloro-6-propoxy-1,3,5-triazin-2-yl)quinoline |
| PubChem CID | 81230886 |
| Molecular Formula | C15H13ClN4O |
| Molecular Weight | 300.75 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 7-(4-chloro-6-propoxy-1,3,5-triazin-2-yl)quinoline |
| SMILES | CCCOc1nc(Cl)nc(-c2ccc3cccnc3c2)n1 |
| InChI | InChI=1S/C15H13ClN4O/c1-2-8-21-15-19-13(18-14(16)20-15)11-6-5-10-4-3-7-17-12(10)9-11/h3-7,9H,2,8H2,1H3 |
| InChIKey | WLEFLQCAINPABX-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 60.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.75 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-(4-chloro-6-propoxy-1,3,5-triazin-2-yl)quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(4-chloro-6-propoxy-1,3,5-triazin-2-yl)quinoline?
The IUPAC name of 7-(4-chloro-6-propoxy-1,3,5-triazin-2-yl)quinoline (CID 81230886) is 7-(4-chloro-6-propoxy-1,3,5-triazin-2-yl)quinoline.
What is the SMILES notation for 7-(4-chloro-6-propoxy-1,3,5-triazin-2-yl)quinoline?
The canonical SMILES for 7-(4-chloro-6-propoxy-1,3,5-triazin-2-yl)quinoline is CCCOc1nc(Cl)nc(-c2ccc3cccnc3c2)n1.
What is the InChIKey of 7-(4-chloro-6-propoxy-1,3,5-triazin-2-yl)quinoline?
The InChIKey is WLEFLQCAINPABX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13ClN4O/c1-2-8-21-15-19-13(18-14(16)20-15)11-6-5-10-4-3-7-17-12(10)9-11/h3-7,9H,2,8H2,1H3.
What are the key properties of 7-(4-chloro-6-propoxy-1,3,5-triazin-2-yl)quinoline?
7-(4-chloro-6-propoxy-1,3,5-triazin-2-yl)quinoline has a molecular weight of 300.75 g/mol, XLogP of 3.53, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(4-chloro-6-propoxy-1,3,5-triazin-2-yl)quinoline is sourced from PubChem (CID 81230886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).