C10H10N2O2 — CID 81232269
6-methyl-4-(prop-2-ynylamino)pyridine-3-carboxylic acid (PubChem CID 81232269) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is 6-methyl-4-(prop-2-ynylamino)pyridine-3-carboxylic acid.
| Compound Name | 6-methyl-4-(prop-2-ynylamino)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 81232269 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 6-methyl-4-(prop-2-ynylamino)pyridine-3-carboxylic acid |
| SMILES | C#CCNc1cc(C)ncc1C(=O)O |
| InChI | InChI=1S/C10H10N2O2/c1-3-4-11-9-5-7(2)12-6-8(9)10(13)14/h1,5-6H,4H2,2H3,(H,11,12)(H,13,14) |
| InChIKey | PWGIVDSSVQODRB-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|