C16H18N2O2 — CID 81232443
4-(4-tert-butylanilino)pyridine-3-carboxylic acid (PubChem CID 81232443) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is 4-(4-tert-butylanilino)pyridine-3-carboxylic acid.
| Compound Name | 4-(4-tert-butylanilino)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 81232443 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 4-(4-tert-butylanilino)pyridine-3-carboxylic acid |
| SMILES | CC(C)(C)c1ccc(Nc2ccncc2C(=O)O)cc1 |
| InChI | InChI=1S/C16H18N2O2/c1-16(2,3)11-4-6-12(7-5-11)18-14-8-9-17-10-13(14)15(19)20/h4-10H,1-3H3,(H,17,18)(H,19,20) |
| InChIKey | YBVNJEBRXXPZFU-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |